About 2-cyanatoethyl benzoate
2-cyanatoethyl benzoate (PubChem CID 126625512) has the molecular formula C10H9NO3
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-cyanatoethyl benzoate.
Molecular Properties
| Compound Name | 2-cyanatoethyl benzoate |
| PubChem CID | 126625512 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-cyanatoethyl benzoate |
| SMILES | N#COCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9NO3/c11-8-13-6-7-14-10(12)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| InChIKey | ZITZOQJTGWMFKT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanatoethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanatoethyl benzoate?
The IUPAC name of 2-cyanatoethyl benzoate (CID 126625512) is 2-cyanatoethyl benzoate.
What is the SMILES notation for 2-cyanatoethyl benzoate?
The canonical SMILES for 2-cyanatoethyl benzoate is N#COCCOC(=O)c1ccccc1.
What is the InChIKey of 2-cyanatoethyl benzoate?
The InChIKey is ZITZOQJTGWMFKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3/c11-8-13-6-7-14-10(12)9-4-2-1-3-5-9/h1-5H,6-7H2.
What are the key properties of 2-cyanatoethyl benzoate?
2-cyanatoethyl benzoate has a molecular weight of 191.19 g/mol, XLogP of 1.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanatoethyl benzoate is sourced from PubChem (CID 126625512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).