About 5-cyanopentyl benzoate
5-cyanopentyl benzoate (PubChem CID 118627179) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-cyanopentyl benzoate.
Molecular Properties
| Compound Name | 5-cyanopentyl benzoate |
| PubChem CID | 118627179 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 5-cyanopentyl benzoate |
| SMILES | N#CCCCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c14-10-6-1-2-7-11-16-13(15)12-8-4-3-5-9-12/h3-5,8-9H,1-2,6-7,11H2 |
| InChIKey | SGCZKTCMPPDKHJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyanopentyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyanopentyl benzoate?
The IUPAC name of 5-cyanopentyl benzoate (CID 118627179) is 5-cyanopentyl benzoate.
What is the SMILES notation for 5-cyanopentyl benzoate?
The canonical SMILES for 5-cyanopentyl benzoate is N#CCCCCCOC(=O)c1ccccc1.
What is the InChIKey of 5-cyanopentyl benzoate?
The InChIKey is SGCZKTCMPPDKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c14-10-6-1-2-7-11-16-13(15)12-8-4-3-5-9-12/h3-5,8-9H,1-2,6-7,11H2.
What are the key properties of 5-cyanopentyl benzoate?
5-cyanopentyl benzoate has a molecular weight of 217.27 g/mol, XLogP of 2.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyanopentyl benzoate is sourced from PubChem (CID 118627179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).