C30H22O8 — CID 154278572
1-O-[2-(4-phenoxycarbonylbenzoyl)oxyethyl] 4-O-phenyl benzene-1,4-dicarboxylate (PubChem CID 154278572) has the molecular formula C30H22O8 and a molecular weight of 510.50 g/mol. Its IUPAC name is 1-O-[2-(4-phenoxycarbonylbenzoyl)oxyethyl] 4-O-phenyl benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[2-(4-phenoxycarbonylbenzoyl)oxyethyl] 4-O-phenyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 154278572 |
| Molecular Formula | C30H22O8 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 1-O-[2-(4-phenoxycarbonylbenzoyl)oxyethyl] 4-O-phenyl benzene-1,4-dicarboxylate |
| SMILES | O=C(OCCOC(=O)c1ccc(C(=O)Oc2ccccc2)cc1)c1ccc(C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H22O8/c31-27(21-11-15-23(16-12-21)29(33)37-25-7-3-1-4-8-25)35-19-20-36-28(32)22-13-17-24(18-14-22)30(34)38-26-9-5-2-6-10-26/h1-18H,19-20H2 |
| InChIKey | KRNSXTVMYTVTED-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|