C13H12N2O3 — CID 46679809
2-methyl-1,3-dioxo-N-prop-2-enylisoindole-5-carboxamide (PubChem CID 46679809) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-prop-2-enylisoindole-5-carboxamide.
| Compound Name | 2-methyl-1,3-dioxo-N-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 46679809 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCNC(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C13H12N2O3/c1-3-6-14-11(16)8-4-5-9-10(7-8)13(18)15(2)12(9)17/h3-5,7H,1,6H2,2H3,(H,14,16) |
| InChIKey | JLVXOUAVBSLWND-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|