C23H23N3O5 — CID 37004930
2-(3-methoxypropyl)-1,3-dioxo-N-[2-(prop-2-enylcarbamoyl)phenyl]isoindole-5-carboxamide (PubChem CID 37004930) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-1,3-dioxo-N-[2-(prop-2-enylcarbamoyl)phenyl]isoindole-5-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-1,3-dioxo-N-[2-(prop-2-enylcarbamoyl)phenyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 37004930 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(3-methoxypropyl)-1,3-dioxo-N-[2-(prop-2-enylcarbamoyl)phenyl]isoindole-5-carboxamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1ccc2c(c1)C(=O)N(CCCOC)C2=O |
| InChI | InChI=1S/C23H23N3O5/c1-3-11-24-21(28)17-7-4-5-8-19(17)25-20(27)15-9-10-16-18(14-15)23(30)26(22(16)29)12-6-13-31-2/h3-5,7-10,14H,1,6,11-13H2,2H3,(H,24,28)(H,25,27) |
| InChIKey | NWLBVNFXJVQEPA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|