C29H27N3O7 — CID 108928633
[3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108928633) has the molecular formula C29H27N3O7 and a molecular weight of 529.55 g/mol. Its IUPAC name is [3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928633 |
| Molecular Formula | C29H27N3O7 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | [3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3ccccc3CNC(=O)c3cccc(OC(C)=O)c3)cc2C1=O |
| InChI | InChI=1S/C29H27N3O7/c1-18(33)39-22-9-5-8-19(15-22)26(34)30-17-21-7-3-4-10-25(21)31-27(35)20-11-12-23-24(16-20)29(37)32(28(23)36)13-6-14-38-2/h3-5,7-12,15-16H,6,13-14,17H2,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | ZLEUUGBACFCIEW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|