C23H20N2O6 — CID 108928793
[3-[[2-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] acetate (PubChem CID 108928793) has the molecular formula C23H20N2O6 and a molecular weight of 420.42 g/mol. Its IUPAC name is [3-[[2-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928793 |
| Molecular Formula | C23H20N2O6 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [3-[[2-[(3,5-dihydroxybenzoyl)amino]phenyl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCc2ccccc2NC(=O)c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C23H20N2O6/c1-14(26)31-20-7-4-6-15(11-20)22(29)24-13-16-5-2-3-8-21(16)25-23(30)17-9-18(27)12-19(28)10-17/h2-12,27-28H,13H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | AVMXIMKAQLZECT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|