C25H24N2O6 — CID 108928616
[3-[[2-[[2-(4-hydroxyphenoxy)propanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928616) has the molecular formula C25H24N2O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is [3-[[2-[[2-(4-hydroxyphenoxy)propanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[[2-(4-hydroxyphenoxy)propanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928616 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [3-[[2-[[2-(4-hydroxyphenoxy)propanoylamino]methyl]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccccc2CNC(=O)C(C)Oc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C25H24N2O6/c1-16(32-21-12-10-20(29)11-13-21)24(30)26-15-19-6-3-4-9-23(19)27-25(31)18-7-5-8-22(14-18)33-17(2)28/h3-14,16,29H,15H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | CGFKGCDIYKNXIX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|