C28H34N4O7 — CID 108920847
tert-butyl N-[3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 108920847) has the molecular formula C28H34N4O7 and a molecular weight of 538.60 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108920847 |
| Molecular Formula | C28H34N4O7 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | tert-butyl N-[3-[[2-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3ccccc3CNC(=O)CCNC(=O)OC(C)(C)C)cc2C1=O |
| InChI | InChI=1S/C28H34N4O7/c1-28(2,3)39-27(37)29-13-12-23(33)30-17-19-8-5-6-9-22(19)31-24(34)18-10-11-20-21(16-18)26(36)32(25(20)35)14-7-15-38-4/h5-6,8-11,16H,7,12-15,17H2,1-4H3,(H,29,37)(H,30,33)(H,31,34) |
| InChIKey | NGLSEULZONNRFB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|