C18H27N3O5 — CID 108918087
tert-butyl N-[2-[2-[(3-methoxypropanoylamino)methyl]anilino]-2-oxoethyl]carbamate (PubChem CID 108918087) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(3-methoxypropanoylamino)methyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(3-methoxypropanoylamino)methyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918087 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | tert-butyl N-[2-[2-[(3-methoxypropanoylamino)methyl]anilino]-2-oxoethyl]carbamate |
| SMILES | COCCC(=O)NCc1ccccc1NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27N3O5/c1-18(2,3)26-17(24)20-12-16(23)21-14-8-6-5-7-13(14)11-19-15(22)9-10-25-4/h5-8H,9-12H2,1-4H3,(H,19,22)(H,20,24)(H,21,23) |
| InChIKey | DVNYIXPSSKANEW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |