C21H31N3O4 — CID 108918249
tert-butyl N-[2-[2-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate (PubChem CID 108918249) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108918249 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[2-[2-[[[(E)-4,4-dimethylpent-2-enoyl]amino]methyl]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)/C=C/C(=O)NCc1ccccc1NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O4/c1-20(2,3)12-11-17(25)22-13-15-9-7-8-10-16(15)24-18(26)14-23-19(27)28-21(4,5)6/h7-12H,13-14H2,1-6H3,(H,22,25)(H,23,27)(H,24,26)/b12-11+ |
| InChIKey | WYTIMFGVELUWCT-VAWYXSNFSA-N |
| XLogP | 3.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|