C17H23N3O4 — CID 108917462
tert-butyl N-[2-[2-[[(E)-but-2-enoyl]amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108917462) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[(E)-but-2-enoyl]amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[(E)-but-2-enoyl]amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917462 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | tert-butyl N-[2-[2-[[(E)-but-2-enoyl]amino]anilino]-2-oxoethyl]carbamate |
| SMILES | C/C=C/C(=O)Nc1ccccc1NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N3O4/c1-5-8-14(21)19-12-9-6-7-10-13(12)20-15(22)11-18-16(23)24-17(2,3)4/h5-10H,11H2,1-4H3,(H,18,23)(H,19,21)(H,20,22)/b8-5+ |
| InChIKey | GIZGRMXUMNDNEG-VMPITWQZSA-N |
| XLogP | 2.66 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|