C23H29N3O4 — CID 108920777
tert-butyl N-[3-[[2-[(4-methylbenzoyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 108920777) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-[(4-methylbenzoyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-[(4-methylbenzoyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108920777 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | tert-butyl N-[3-[[2-[(4-methylbenzoyl)amino]phenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2CNC(=O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29N3O4/c1-16-9-11-17(12-10-16)21(28)26-19-8-6-5-7-18(19)15-25-20(27)13-14-24-22(29)30-23(2,3)4/h5-12H,13-15H2,1-4H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | LOVUOGPXKOHINE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |