C21H31N3O4 — CID 108921123
tert-butyl N-[3-[[2-[[(E)-4-methylpent-2-enoyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 108921123) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-[[(E)-4-methylpent-2-enoyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-[[(E)-4-methylpent-2-enoyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921123 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[3-[[2-[[(E)-4-methylpent-2-enoyl]amino]phenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | CC(C)/C=C/C(=O)Nc1ccccc1CNC(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O4/c1-15(2)10-11-19(26)24-17-9-7-6-8-16(17)14-23-18(25)12-13-22-20(27)28-21(3,4)5/h6-11,15H,12-14H2,1-5H3,(H,22,27)(H,23,25)(H,24,26)/b11-10+ |
| InChIKey | QCDFBRWJRDZZHW-ZHACJKMWSA-N |
| XLogP | 3.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|