C26H30N4O7 — CID 108916927
tert-butyl N-[2-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-2-oxoethyl]carbamate (PubChem CID 108916927) has the molecular formula C26H30N4O7 and a molecular weight of 510.55 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916927 |
| Molecular Formula | C26H30N4O7 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | tert-butyl N-[2-[4-[[2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-2-oxoethyl]carbamate |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3ccc(NC(=O)CNC(=O)OC(C)(C)C)cc3)cc2C1=O |
| InChI | InChI=1S/C26H30N4O7/c1-26(2,3)37-25(35)27-15-21(31)28-17-7-9-18(10-8-17)29-22(32)16-6-11-19-20(14-16)24(34)30(23(19)33)12-5-13-36-4/h6-11,14H,5,12-13,15H2,1-4H3,(H,27,35)(H,28,31)(H,29,32) |
| InChIKey | YIEBZJUYLMXFEB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|