C26H30N4O6 — CID 108917559
tert-butyl N-[2-[[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate (PubChem CID 108917559) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917559 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | tert-butyl N-[2-[[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]phenyl]methylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)Nc3ccc(CNC(=O)CNC(=O)OC(C)(C)C)cc3)cc2C1=O |
| InChI | InChI=1S/C26H30N4O6/c1-15(2)30-23(33)19-11-8-17(12-20(19)24(30)34)22(32)29-18-9-6-16(7-10-18)13-27-21(31)14-28-25(35)36-26(3,4)5/h6-12,15H,13-14H2,1-5H3,(H,27,31)(H,28,35)(H,29,32) |
| InChIKey | ATLWLSVYZAXIIH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|