C27H32N4O6 — CID 108919833
tert-butyl N-[3-[4-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-3-oxopropyl]carbamate (PubChem CID 108919833) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919833 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | tert-butyl N-[3-[4-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]anilino]-3-oxopropyl]carbamate |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)Nc3ccc(NC(=O)CCNC(=O)OC(C)(C)C)cc3)cc2C1=O |
| InChI | InChI=1S/C27H32N4O6/c1-16(2)15-31-24(34)20-11-6-17(14-21(20)25(31)35)23(33)30-19-9-7-18(8-10-19)29-22(32)12-13-28-26(36)37-27(3,4)5/h6-11,14,16H,12-13,15H2,1-5H3,(H,28,36)(H,29,32)(H,30,33) |
| InChIKey | GRLMTCMNGGUKRZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|