C24H32N4O6 — CID 108916710
tert-butyl N-[2-[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]piperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 108916710) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]piperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]piperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916710 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl N-[2-[4-[(1,3-dioxo-2-propan-2-ylisoindole-5-carbonyl)amino]piperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)NC3CCN(C(=O)CNC(=O)OC(C)(C)C)CC3)cc2C1=O |
| InChI | InChI=1S/C24H32N4O6/c1-14(2)28-21(31)17-7-6-15(12-18(17)22(28)32)20(30)26-16-8-10-27(11-9-16)19(29)13-25-23(33)34-24(3,4)5/h6-7,12,14,16H,8-11,13H2,1-5H3,(H,25,33)(H,26,30) |
| InChIKey | DDCDMJSWXSXEBK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|