C28H38N4O6 — CID 108916398
tert-butyl N-[2-[4-[[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]piperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 108916398) has the molecular formula C28H38N4O6 and a molecular weight of 526.63 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]piperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]piperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916398 |
| Molecular Formula | C28H38N4O6 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | tert-butyl N-[2-[4-[[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]methyl]piperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCC(CNC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)CC1 |
| InChI | InChI=1S/C28H38N4O6/c1-28(2,3)38-27(37)30-17-23(33)31-13-11-18(12-14-31)16-29-24(34)19-9-10-21-22(15-19)26(36)32(25(21)35)20-7-5-4-6-8-20/h9-10,15,18,20H,4-8,11-14,16-17H2,1-3H3,(H,29,34)(H,30,37) |
| InChIKey | KVMKJGFFJSLXQL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|