C23H20N4O6 — CID 169211208
N-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]butyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 169211208) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]butyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]butyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 169211208 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[4-[(1,3-dioxoisoindole-5-carbonyl)amino]butyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)NCCCCNC(=O)c3ccc4c(c3)C(=O)NC4=O)cc2C1=O |
| InChI | InChI=1S/C23H20N4O6/c1-27-22(32)15-7-5-13(11-17(15)23(27)33)19(29)25-9-3-2-8-24-18(28)12-4-6-14-16(10-12)21(31)26-20(14)30/h4-7,10-11H,2-3,8-9H2,1H3,(H,24,28)(H,25,29)(H,26,30,31) |
| InChIKey | YYVVYLRXQJFLRQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|