C39H22N2O12 — CID 166848649
[4-[4-[4-(1,3-dioxoisoindole-5-carbonyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 166848649) has the molecular formula C39H22N2O12 and a molecular weight of 710.61 g/mol. Its IUPAC name is [4-[4-[4-(1,3-dioxoisoindole-5-carbonyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[4-[4-(1,3-dioxoisoindole-5-carbonyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 166848649 |
| Molecular Formula | C39H22N2O12 |
| Molecular Weight | 710.61 g/mol |
| Exact Mass | 710.12 |
| IUPAC Name | [4-[4-[4-(1,3-dioxoisoindole-5-carbonyl)oxybenzoyl]oxyphenoxy]carbonylphenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CN1C(=O)c2ccc(C(=O)Oc3ccc(C(=O)Oc4ccc(OC(=O)c5ccc(OC(=O)c6ccc7c(c6)C(=O)NC7=O)cc5)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C39H22N2O12/c1-41-34(44)29-17-7-23(19-31(29)35(41)45)39(49)53-25-10-4-21(5-11-25)37(47)51-27-14-12-26(13-15-27)50-36(46)20-2-8-24(9-3-20)52-38(48)22-6-16-28-30(18-22)33(43)40-32(28)42/h2-19H,1H3,(H,40,42,43) |
| InChIKey | FKYRYWVMYMKITP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 188.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|