C41H27F3N2O8 — CID 163749300
[4-[4-[1,3-dioxo-5-[1,1,1-trifluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindol-2-yl]benzoyl]oxyphenyl] 4-methylbenzoate (PubChem CID 163749300) has the molecular formula C41H27F3N2O8 and a molecular weight of 732.67 g/mol. Its IUPAC name is [4-[4-[1,3-dioxo-5-[1,1,1-trifluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindol-2-yl]benzoyl]oxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[4-[1,3-dioxo-5-[1,1,1-trifluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindol-2-yl]benzoyl]oxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 163749300 |
| Molecular Formula | C41H27F3N2O8 |
| Molecular Weight | 732.67 g/mol |
| Exact Mass | 732.17 |
| IUPAC Name | [4-[4-[1,3-dioxo-5-[1,1,1-trifluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]isoindol-2-yl]benzoyl]oxyphenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(N4C(=O)c5ccc(C(C)(c6ccc7c(c6)C(=O)N(C)C7=O)C(F)(F)F)cc5C4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H27F3N2O8/c1-22-4-6-23(7-5-22)38(51)53-28-14-16-29(17-15-28)54-39(52)24-8-12-27(13-9-24)46-36(49)31-19-11-26(21-33(31)37(46)50)40(2,41(42,43)44)25-10-18-30-32(20-25)35(48)45(3)34(30)47/h4-21H,1-3H3 |
| InChIKey | LOPQONCHMIMZID-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.67 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|