C40H24N2O12 — CID 3094255
[4-[2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl] 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3094255) has the molecular formula C40H24N2O12 and a molecular weight of 724.63 g/mol. Its IUPAC name is [4-[2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl] 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl] 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3094255 |
| Molecular Formula | C40H24N2O12 |
| Molecular Weight | 724.63 g/mol |
| Exact Mass | 724.13 |
| IUPAC Name | [4-[2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl] 2-(4-acetyloxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)c3ccc(C(=O)Oc4ccc(OC(=O)c5ccc6c(c5)C(=O)N(c5ccc(OC(C)=O)cc5)C6=O)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C40H24N2O12/c1-21(43)51-27-9-5-25(6-10-27)41-35(45)31-17-3-23(19-33(31)37(41)47)39(49)53-29-13-15-30(16-14-29)54-40(50)24-4-18-32-34(20-24)38(48)42(36(32)46)26-7-11-28(12-8-26)52-22(2)44/h3-20H,1-2H3 |
| InChIKey | OSDKGUOHBKMGDB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 179.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.63 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|