C23H16N2O5 — CID 19132744
(4-acetamidophenyl) 1,3-dioxo-2-phenylisoindole-5-carboxylate (PubChem CID 19132744) has the molecular formula C23H16N2O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is (4-acetamidophenyl) 1,3-dioxo-2-phenylisoindole-5-carboxylate.
| Compound Name | (4-acetamidophenyl) 1,3-dioxo-2-phenylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 19132744 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (4-acetamidophenyl) 1,3-dioxo-2-phenylisoindole-5-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C23H16N2O5/c1-14(26)24-16-8-10-18(11-9-16)30-23(29)15-7-12-19-20(13-15)22(28)25(21(19)27)17-5-3-2-4-6-17/h2-13H,1H3,(H,24,26) |
| InChIKey | NLXANVOMGYCYAW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|