C21H12N2O6 — CID 5096249
phenyl 2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 5096249) has the molecular formula C21H12N2O6 and a molecular weight of 388.34 g/mol. Its IUPAC name is phenyl 2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | phenyl 2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 5096249 |
| Molecular Formula | C21H12N2O6 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | phenyl 2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1ccc2c(c1)C(=O)N(c1cccc([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C21H12N2O6/c24-19-17-10-9-13(21(26)29-16-7-2-1-3-8-16)11-18(17)20(25)22(19)14-5-4-6-15(12-14)23(27)28/h1-12H |
| InChIKey | NPRNIZMAQWOFMH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|