C14H6Cl2N2O4 — CID 3794451
5,6-dichloro-2-(3-nitrophenyl)isoindole-1,3-dione (PubChem CID 3794451) has the molecular formula C14H6Cl2N2O4 and a molecular weight of 337.12 g/mol. Its IUPAC name is 5,6-dichloro-2-(3-nitrophenyl)isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-(3-nitrophenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 3794451 |
| Molecular Formula | C14H6Cl2N2O4 |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 5,6-dichloro-2-(3-nitrophenyl)isoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H6Cl2N2O4/c15-11-5-9-10(6-12(11)16)14(20)17(13(9)19)7-2-1-3-8(4-7)18(21)22/h1-6H |
| InChIKey | IXQQEYBPSWOXHT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|