C12H6N4O4 — CID 154155220
6-(3-nitrophenyl)pyrrolo[3,4-b]pyrazine-5,7-dione (PubChem CID 154155220) has the molecular formula C12H6N4O4 and a molecular weight of 270.20 g/mol. Its IUPAC name is 6-(3-nitrophenyl)pyrrolo[3,4-b]pyrazine-5,7-dione.
| Compound Name | 6-(3-nitrophenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 154155220 |
| Molecular Formula | C12H6N4O4 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 6-(3-nitrophenyl)pyrrolo[3,4-b]pyrazine-5,7-dione |
| SMILES | O=C1c2nccnc2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6N4O4/c17-11-9-10(14-5-4-13-9)12(18)15(11)7-2-1-3-8(6-7)16(19)20/h1-6H |
| InChIKey | DOGFHAALXCUVMB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 106.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|