C21H14N4O5 — CID 1083287
N-(3-methyl-2-pyridinyl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 1083287) has the molecular formula C21H14N4O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 1083287 |
| Molecular Formula | C21H14N4O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1cccnc1NC(=O)c1ccc2c(c1)C(=O)N(c1cccc([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C21H14N4O5/c1-12-4-3-9-22-18(12)23-19(26)13-7-8-16-17(10-13)21(28)24(20(16)27)14-5-2-6-15(11-14)25(29)30/h2-11H,1H3,(H,22,23,26) |
| InChIKey | ZXFDUKNPLYVOMR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|