C18H12N4O5S — CID 9322343
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 9322343) has the molecular formula C18H12N4O5S and a molecular weight of 396.38 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 9322343 |
| Molecular Formula | C18H12N4O5S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-(3-nitrophenyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(NC1=NCCS1)c1ccc2c(c1)C(=O)N(c1cccc([N+](=O)[O-])c1)C2=O |
| InChI | InChI=1S/C18H12N4O5S/c23-15(20-18-19-6-7-28-18)10-4-5-13-14(8-10)17(25)21(16(13)24)11-2-1-3-12(9-11)22(26)27/h1-5,8-9H,6-7H2,(H,19,20,23) |
| InChIKey | SDXDZJDFQUFROZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|