C23H15N3O8 — CID 17341861
2-[3-[[3-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]phenoxy]acetic acid (PubChem CID 17341861) has the molecular formula C23H15N3O8 and a molecular weight of 461.39 g/mol. Its IUPAC name is 2-[3-[[3-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[3-[[3-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 17341861 |
| Molecular Formula | C23H15N3O8 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 2-[3-[[3-(5-nitro-1,3-dioxoisoindol-2-yl)benzoyl]amino]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(NC(=O)c2cccc(N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)c2)c1 |
| InChI | InChI=1S/C23H15N3O8/c27-20(28)12-34-17-6-2-4-14(10-17)24-21(29)13-3-1-5-15(9-13)25-22(30)18-8-7-16(26(32)33)11-19(18)23(25)31/h1-11H,12H2,(H,24,29)(H,27,28) |
| InChIKey | BJBWDIPNLCKUIE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|