C25H14N4O7 — CID 132829061
3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(4-nitrophenyl)benzamide (PubChem CID 132829061) has the molecular formula C25H14N4O7 and a molecular weight of 482.41 g/mol. Its IUPAC name is 3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(4-nitrophenyl)benzamide.
| Compound Name | 3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(4-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 132829061 |
| Molecular Formula | C25H14N4O7 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(4-nitrophenyl)benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)c1cccc(N2C(=O)c3cccc4c([N+](=O)[O-])ccc(c34)C2=O)c1 |
| InChI | InChI=1S/C25H14N4O7/c30-23(26-15-7-9-16(10-8-15)28(33)34)14-3-1-4-17(13-14)27-24(31)19-6-2-5-18-21(29(35)36)12-11-20(22(18)19)25(27)32/h1-13H,(H,26,30) |
| InChIKey | NNHSHXOXNUIHKS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|