C26H15N3O7 — CID 3304388
2-[[3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoyl]amino]benzoic acid (PubChem CID 3304388) has the molecular formula C26H15N3O7 and a molecular weight of 481.42 g/mol. Its IUPAC name is 2-[[3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoyl]amino]benzoic acid.
| Compound Name | 2-[[3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 3304388 |
| Molecular Formula | C26H15N3O7 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | 2-[[3-(6-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)benzoyl]amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1cccc(N2C(=O)c3cccc4c([N+](=O)[O-])ccc(c34)C2=O)c1 |
| InChI | InChI=1S/C26H15N3O7/c30-23(27-20-10-2-1-7-16(20)26(33)34)14-5-3-6-15(13-14)28-24(31)18-9-4-8-17-21(29(35)36)12-11-19(22(17)18)25(28)32/h1-13H,(H,27,30)(H,33,34) |
| InChIKey | MMUPKDGBDSMILM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|