C20H13N3O6 — CID 17296222
N-(furan-2-ylmethyl)-3-(5-nitro-1,3-dioxoisoindol-2-yl)benzamide (PubChem CID 17296222) has the molecular formula C20H13N3O6 and a molecular weight of 391.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-(5-nitro-1,3-dioxoisoindol-2-yl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-(5-nitro-1,3-dioxoisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 17296222 |
| Molecular Formula | C20H13N3O6 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-(5-nitro-1,3-dioxoisoindol-2-yl)benzamide |
| SMILES | O=C(NCc1ccco1)c1cccc(N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c1 |
| InChI | InChI=1S/C20H13N3O6/c24-18(21-11-15-5-2-8-29-15)12-3-1-4-13(9-12)22-19(25)16-7-6-14(23(27)28)10-17(16)20(22)26/h1-10H,11H2,(H,21,24) |
| InChIKey | XBJOSBJXLQCMKX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 122.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|