C25H19N5O5 — CID 19400423
4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 19400423) has the molecular formula C25H19N5O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19400423 |
| Molecular Formula | C25H19N5O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C25H19N5O5/c1-29-14-20(21(28-29)23(32)26-13-17-8-5-11-35-17)27-22(31)15-6-4-7-16(12-15)30-24(33)18-9-2-3-10-19(18)25(30)34/h2-12,14H,13H2,1H3,(H,26,32)(H,27,31) |
| InChIKey | HTXPJCDTMXGXSF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|