C25H25N5O4 — CID 19402528
4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19402528) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19402528 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 4-[[3-(1,3-dioxoisoindol-2-yl)benzoyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C25H25N5O4/c1-4-29-14-20(21(28-29)23(32)26-13-15(2)3)27-22(31)16-8-7-9-17(12-16)30-24(33)18-10-5-6-11-19(18)25(30)34/h5-12,14-15H,4,13H2,1-3H3,(H,26,32)(H,27,31) |
| InChIKey | AAXBWFDMFDBTBF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|