C15H27N5O2 — CID 19448031
4-(butylcarbamoylamino)-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19448031) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-(butylcarbamoylamino)-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 4-(butylcarbamoylamino)-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19448031 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 4-(butylcarbamoylamino)-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)Nc1cn(CC)nc1C(=O)NCC(C)C |
| InChI | InChI=1S/C15H27N5O2/c1-5-7-8-16-15(22)18-12-10-20(6-2)19-13(12)14(21)17-9-11(3)4/h10-11H,5-9H2,1-4H3,(H,17,21)(H2,16,18,22) |
| InChIKey | NCANFRJPYYZGBN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|