C18H27N7O4 — CID 19553609
1-ethyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19553609) has the molecular formula C18H27N7O4 and a molecular weight of 405.46 g/mol. Its IUPAC name is 1-ethyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19553609 |
| Molecular Formula | C18H27N7O4 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-ethyl-4-[2-(5-methyl-3-nitropyrazol-1-yl)butanoylamino]-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCC(C(=O)Nc1cn(CC)nc1C(=O)NCC(C)C)n1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C18H27N7O4/c1-6-14(24-12(5)8-15(21-24)25(28)29)17(26)20-13-10-23(7-2)22-16(13)18(27)19-9-11(3)4/h8,10-11,14H,6-7,9H2,1-5H3,(H,19,27)(H,20,26) |
| InChIKey | KUULAELOFLGKLC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|