C17H23F2N7O4 — CID 19529203
4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19529203) has the molecular formula C17H23F2N7O4 and a molecular weight of 427.41 g/mol. Its IUPAC name is 4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19529203 |
| Molecular Formula | C17H23F2N7O4 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)Cn2nc(C(F)F)c([N+](=O)[O-])c2C)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C17H23F2N7O4/c1-5-24-7-11(13(22-24)17(28)20-6-9(2)3)21-12(27)8-25-10(4)15(26(29)30)14(23-25)16(18)19/h7,9,16H,5-6,8H2,1-4H3,(H,20,28)(H,21,27) |
| InChIKey | LVWGHIIBCPOLRX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|