C15H19F2N7O4 — CID 19529241
4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N,N-dimethylpyrazole-5-carboxamide (PubChem CID 19529241) has the molecular formula C15H19F2N7O4 and a molecular weight of 399.36 g/mol. Its IUPAC name is 4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N,N-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N,N-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19529241 |
| Molecular Formula | C15H19F2N7O4 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-1-ethyl-N,N-dimethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=O)Cn2nc(C(F)F)c([N+](=O)[O-])c2C)c1C(=O)N(C)C |
| InChI | InChI=1S/C15H19F2N7O4/c1-5-22-13(15(26)21(3)4)9(6-18-22)19-10(25)7-23-8(2)12(24(27)28)11(20-23)14(16)17/h6,14H,5,7H2,1-4H3,(H,19,25) |
| InChIKey | MCSMFPMOAUWLRL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|