C17H20ClN9O4 — CID 19529522
4-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide (PubChem CID 19529522) has the molecular formula C17H20ClN9O4 and a molecular weight of 449.86 g/mol. Its IUPAC name is 4-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19529522 |
| Molecular Formula | C17H20ClN9O4 |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 4-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=O)Cn2nc([N+](=O)[O-])c(Cl)c2C)c1C(=O)Nc1cnn(C)c1C |
| InChI | InChI=1S/C17H20ClN9O4/c1-5-25-15(17(29)22-11-6-19-24(4)9(11)2)12(7-20-25)21-13(28)8-26-10(3)14(18)16(23-26)27(30)31/h6-7H,5,8H2,1-4H3,(H,21,28)(H,22,29) |
| InChIKey | OYLSHRZEIWIDRU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|