C21H25N11O4 — CID 19265048
4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide (PubChem CID 19265048) has the molecular formula C21H25N11O4 and a molecular weight of 495.50 g/mol. Its IUPAC name is 4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19265048 |
| Molecular Formula | C21H25N11O4 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(1,5-dimethylpyrazol-4-yl)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=O)c2ccn(Cn3nc(C)c([N+](=O)[O-])c3C)n2)c1C(=O)Nc1cnn(C)c1C |
| InChI | InChI=1S/C21H25N11O4/c1-6-30-19(21(34)24-16-9-22-28(5)13(16)3)17(10-23-30)25-20(33)15-7-8-29(27-15)11-31-14(4)18(32(35)36)12(2)26-31/h7-10H,6,11H2,1-5H3,(H,24,34)(H,25,33) |
| InChIKey | GSUBAEICVRDGDL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 172.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|