C19H22N10O3 — CID 19265051
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19265051) has the molecular formula C19H22N10O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265051 |
| Molecular Formula | C19H22N10O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-[(1-ethylpyrazol-4-yl)methyl]pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Cn2cc(NC(=O)c3ccn(Cn4nc(C)c([N+](=O)[O-])c4C)n3)cn2)cn1 |
| InChI | InChI=1S/C19H22N10O3/c1-4-25-9-15(7-20-25)10-27-11-16(8-21-27)22-19(30)17-5-6-26(24-17)12-28-14(3)18(29(31)32)13(2)23-28/h5-9,11H,4,10,12H2,1-3H3,(H,22,30) |
| InChIKey | SUSAZPVSIBIAIP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|