C22H23N9O4 — CID 19264997
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide (PubChem CID 19264997) has the molecular formula C22H23N9O4 and a molecular weight of 477.49 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264997 |
| Molecular Formula | C22H23N9O4 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]pyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)Nc1cccc(NC(=O)c2ccn(Cn3nc(C)c([N+](=O)[O-])c3C)n2)c1 |
| InChI | InChI=1S/C22H23N9O4/c1-4-29-19(8-10-23-29)22(33)25-17-7-5-6-16(12-17)24-21(32)18-9-11-28(27-18)13-30-15(3)20(31(34)35)14(2)26-30/h5-12H,4,13H2,1-3H3,(H,24,32)(H,25,33) |
| InChIKey | LXRWQYVVUQDJSD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|