C17H17N7O4 — CID 19264027
N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 19264027) has the molecular formula C17H17N7O4 and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264027 |
| Molecular Formula | C17H17N7O4 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[3-[(2-ethylpyrazole-3-carbonyl)amino]phenyl]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)Nc1cccc(NC(=O)c2nn(C)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N7O4/c1-3-23-13(7-8-18-23)16(25)19-11-5-4-6-12(9-11)20-17(26)15-14(24(27)28)10-22(2)21-15/h4-10H,3H2,1-2H3,(H,19,25)(H,20,26) |
| InChIKey | GDIWGXZRDGPEDO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|