C18H19N7O4 — CID 19555628
2-ethyl-N-[3-[3-(4-nitropyrazol-1-yl)propanoylamino]phenyl]pyrazole-3-carboxamide (PubChem CID 19555628) has the molecular formula C18H19N7O4 and a molecular weight of 397.40 g/mol. Its IUPAC name is 2-ethyl-N-[3-[3-(4-nitropyrazol-1-yl)propanoylamino]phenyl]pyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-[3-[3-(4-nitropyrazol-1-yl)propanoylamino]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19555628 |
| Molecular Formula | C18H19N7O4 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-ethyl-N-[3-[3-(4-nitropyrazol-1-yl)propanoylamino]phenyl]pyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)Nc1cccc(NC(=O)CCn2cc([N+](=O)[O-])cn2)c1 |
| InChI | InChI=1S/C18H19N7O4/c1-2-24-16(6-8-19-24)18(27)22-14-5-3-4-13(10-14)21-17(26)7-9-23-12-15(11-20-23)25(28)29/h3-6,8,10-12H,2,7,9H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | ZMCOIEKXLLOBRR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|