C16H20N8O4 — CID 19265053
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-(ethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide (PubChem CID 19265053) has the molecular formula C16H20N8O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-(ethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-(ethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265053 |
| Molecular Formula | C16H20N8O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[1-(ethoxymethyl)pyrazol-4-yl]pyrazole-3-carboxamide |
| SMILES | CCOCn1cc(NC(=O)c2ccn(Cn3nc(C)c([N+](=O)[O-])c3C)n2)cn1 |
| InChI | InChI=1S/C16H20N8O4/c1-4-28-10-22-8-13(7-17-22)18-16(25)14-5-6-21(20-14)9-23-12(3)15(24(26)27)11(2)19-23/h5-8H,4,9-10H2,1-3H3,(H,18,25) |
| InChIKey | HANIJXRDKFCDFE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|