C11H15N5O2 — CID 19262670
N-[1-(ethoxymethyl)pyrazol-4-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 19262670) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-[1-(ethoxymethyl)pyrazol-4-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[1-(ethoxymethyl)pyrazol-4-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262670 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-[1-(ethoxymethyl)pyrazol-4-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | CCOCn1cc(NC(=O)c2ccn(C)n2)cn1 |
| InChI | InChI=1S/C11H15N5O2/c1-3-18-8-16-7-9(6-12-16)13-11(17)10-4-5-15(2)14-10/h4-7H,3,8H2,1-2H3,(H,13,17) |
| InChIKey | CCEHUZJCSZPCSG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |