C12H17N5O2 — CID 19475516
N-[1-(ethoxymethyl)pyrazol-4-yl]-2-ethylpyrazole-3-carboxamide (PubChem CID 19475516) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[1-(ethoxymethyl)pyrazol-4-yl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[1-(ethoxymethyl)pyrazol-4-yl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475516 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-[1-(ethoxymethyl)pyrazol-4-yl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCOCn1cc(NC(=O)c2ccnn2CC)cn1 |
| InChI | InChI=1S/C12H17N5O2/c1-3-17-11(5-6-13-17)12(18)15-10-7-14-16(8-10)9-19-4-2/h5-8H,3-4,9H2,1-2H3,(H,15,18) |
| InChIKey | YKMBDWWAKZJKAM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |