C13H19N5O2 — CID 19474460
N-[1-(ethoxymethyl)pyrazol-4-yl]-1-ethyl-3-methylpyrazole-4-carboxamide (PubChem CID 19474460) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[1-(ethoxymethyl)pyrazol-4-yl]-1-ethyl-3-methylpyrazole-4-carboxamide.
| Compound Name | N-[1-(ethoxymethyl)pyrazol-4-yl]-1-ethyl-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19474460 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[1-(ethoxymethyl)pyrazol-4-yl]-1-ethyl-3-methylpyrazole-4-carboxamide |
| SMILES | CCOCn1cc(NC(=O)c2cn(CC)nc2C)cn1 |
| InChI | InChI=1S/C13H19N5O2/c1-4-17-8-12(10(3)16-17)13(19)15-11-6-14-18(7-11)9-20-5-2/h6-8H,4-5,9H2,1-3H3,(H,15,19) |
| InChIKey | WAWSOHLCRHQMGE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |