C20H22N6O6S — CID 19264824
ethyl 5-acetyl-2-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 19264824) has the molecular formula C20H22N6O6S and a molecular weight of 474.50 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19264824 |
| Molecular Formula | C20H22N6O6S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | ethyl 5-acetyl-2-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccn(Cn3nc(C)c([N+](=O)[O-])c3C)n2)sc(C(C)=O)c1C |
| InChI | InChI=1S/C20H22N6O6S/c1-6-32-20(29)15-10(2)17(13(5)27)33-19(15)21-18(28)14-7-8-24(23-14)9-25-12(4)16(26(30)31)11(3)22-25/h7-8H,6,9H2,1-5H3,(H,21,28) |
| InChIKey | UNAORYPNFVULLZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 151.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|